C36H68O2 — CID 91232492
11-ethenyl-2,3,3,8,8,9,9,12,12,13,13,17,17,18-tetradecamethylicosa-5,15-diene-2,18-diol (PubChem CID 91232492) has the molecular formula C36H68O2 and a molecular weight of 532.94 g/mol. Its IUPAC name is 11-ethenyl-2,3,3,8,8,9,9,12,12,13,13,17,17,18-tetradecamethylicosa-5,15-diene-2,18-diol.
| Compound Name | 11-ethenyl-2,3,3,8,8,9,9,12,12,13,13,17,17,18-tetradecamethylicosa-5,15-diene-2,18-diol |
|---|---|
| PubChem CID | 91232492 |
| Molecular Formula | C36H68O2 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.52 |
| IUPAC Name | 11-ethenyl-2,3,3,8,8,9,9,12,12,13,13,17,17,18-tetradecamethylicosa-5,15-diene-2,18-diol |
| SMILES | C=CC(CC(C)(C)C(C)(C)CC=CCC(C)(C)C(C)(C)O)C(C)(C)C(C)(C)CC=CC(C)(C)C(C)(O)CC |
| InChI | InChI=1S/C36H68O2/c1-18-28(34(13,14)30(5,6)25-22-26-32(9,10)36(17,38)19-2)27-33(11,12)29(3,4)23-20-21-24-31(7,8)35(15,16)37/h18,20-22,26,28,37-38H,1,19,23-25,27H2,2-17H3 |
| InChIKey | NBAYTUKLKRMTRR-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|