About N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide
N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 9123260) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 9123260 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC2CCCCCC2)s1 |
| InChI | InChI=1S/C13H20N2OS/c1-9-12(17-10(2)14-9)13(16)15-11-7-5-3-4-6-8-11/h11H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | JJKHZGHDEUCSQD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide (CID 9123260) is N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide is Cc1nc(C)c(C(=O)NC2CCCCCC2)s1.
What is the InChIKey of N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is JJKHZGHDEUCSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-9-12(17-10(2)14-9)13(16)15-11-7-5-3-4-6-8-11/h11H,3-8H2,1-2H3,(H,15,16).
What are the key properties of N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide?
N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 252.38 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 9123260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).