C8H10NO+ — CID 91233341
(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 91233341) has the molecular formula C8H10NO+ and a molecular weight of 136.17 g/mol. Its IUPAC name is (3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | (3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 91233341 |
| Molecular Formula | C8H10NO+ |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | (3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | CC1=CC(=[NH2+])C=C(C)C1=O |
| InChI | InChI=1S/C8H9NO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,9H,1-2H3/p+1 |
| InChIKey | ISDOHCQSDKUSMT-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 42.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|