C17H16ClN4O+ — CID 91233354
5-(3-chlorophenyl)-2-(4-methylpyrazin-4-ium-2-yl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine (PubChem CID 91233354) has the molecular formula C17H16ClN4O+ and a molecular weight of 327.80 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(4-methylpyrazin-4-ium-2-yl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine.
| Compound Name | 5-(3-chlorophenyl)-2-(4-methylpyrazin-4-ium-2-yl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 91233354 |
| Molecular Formula | C17H16ClN4O+ |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(4-methylpyrazin-4-ium-2-yl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine |
| SMILES | C[n+]1ccnc(-c2nc3c(o2)CCN(c2cccc(Cl)c2)C3)c1 |
| InChI | InChI=1S/C17H16ClN4O/c1-21-8-6-19-15(10-21)17-20-14-11-22(7-5-16(14)23-17)13-4-2-3-12(18)9-13/h2-4,6,8-10H,5,7,11H2,1H3/q+1 |
| InChIKey | OHJWKPITYNXGMN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|