About 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene
9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene (PubChem CID 91234224) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene.
Molecular Properties
| Compound Name | 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene |
| PubChem CID | 91234224 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene |
| SMILES | CC=CC=C1C(=CC)N2CCC1C1C=CC=CC12 |
| InChI | InChI=1S/C17H21N/c1-3-5-8-14-13-11-12-18(16(14)4-2)17-10-7-6-9-15(13)17/h3-10,13,15,17H,11-12H2,1-2H3 |
| InChIKey | CXWCODKRNBSXJF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene?
The IUPAC name of 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene (CID 91234224) is 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene.
What is the SMILES notation for 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene?
The canonical SMILES for 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene is CC=CC=C1C(=CC)N2CCC1C1C=CC=CC12.
What is the InChIKey of 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene?
The InChIKey is CXWCODKRNBSXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-3-5-8-14-13-11-12-18(16(14)4-2)17-10-7-6-9-15(13)17/h3-10,13,15,17H,11-12H2,1-2H3.
What are the key properties of 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene?
9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene has a molecular weight of 239.36 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-but-2-enylidene-10-ethylidene-1-azatricyclo[6.2.2.02,7]dodeca-3,5-diene is sourced from PubChem (CID 91234224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).