C15H17N3O — CID 91234935
1-(5-ethylpyrimidin-2-yl)-1,2,3,4-tetrahydroisoquinolin-5-ol (PubChem CID 91234935) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(5-ethylpyrimidin-2-yl)-1,2,3,4-tetrahydroisoquinolin-5-ol.
| Compound Name | 1-(5-ethylpyrimidin-2-yl)-1,2,3,4-tetrahydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 91234935 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-(5-ethylpyrimidin-2-yl)-1,2,3,4-tetrahydroisoquinolin-5-ol |
| SMILES | CCc1cnc(C2NCCc3c(O)cccc32)nc1 |
| InChI | InChI=1S/C15H17N3O/c1-2-10-8-17-15(18-9-10)14-12-4-3-5-13(19)11(12)6-7-16-14/h3-5,8-9,14,16,19H,2,6-7H2,1H3 |
| InChIKey | MZUNMZMJNYHLJG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |