C10H18O4 — CID 91235356
(2R,3S,4S,5E)-2-(hydroxymethyl)-5-pentylideneoxolane-3,4-diol (PubChem CID 91235356) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2R,3S,4S,5E)-2-(hydroxymethyl)-5-pentylideneoxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5E)-2-(hydroxymethyl)-5-pentylideneoxolane-3,4-diol |
|---|---|
| PubChem CID | 91235356 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2R,3S,4S,5E)-2-(hydroxymethyl)-5-pentylideneoxolane-3,4-diol |
| SMILES | CCCC/C=C1/O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O4/c1-2-3-4-5-7-9(12)10(13)8(6-11)14-7/h5,8-13H,2-4,6H2,1H3/b7-5+/t8-,9-,10-/m1/s1 |
| InChIKey | VIKMHNCQIYDOEC-XCZHVQPTSA-N |
| XLogP | 0.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|