C22H26O5 — CID 91235563
2-(3a-methyl-6-oxospiro[1,2,4,5-tetrahydroindene-3,2'-1,3-dioxolane]-5-yl)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione (PubChem CID 91235563) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3a-methyl-6-oxospiro[1,2,4,5-tetrahydroindene-3,2'-1,3-dioxolane]-5-yl)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione.
| Compound Name | 2-(3a-methyl-6-oxospiro[1,2,4,5-tetrahydroindene-3,2'-1,3-dioxolane]-5-yl)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione |
|---|---|
| PubChem CID | 91235563 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-(3a-methyl-6-oxospiro[1,2,4,5-tetrahydroindene-3,2'-1,3-dioxolane]-5-yl)-7a-methyl-2,3,6,7-tetrahydroindene-1,5-dione |
| SMILES | CC12CCC(=O)C=C1CC(C1CC3(C)C(=CC1=O)CCC31OCCO1)C2=O |
| InChI | InChI=1S/C22H26O5/c1-20-5-4-15(23)9-14(20)10-16(19(20)25)17-12-21(2)13(11-18(17)24)3-6-22(21)26-7-8-27-22/h9,11,16-17H,3-8,10,12H2,1-2H3 |
| InChIKey | RYPPOXOAUZMYJP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |