About 6,6-dinitrohexa-3,5-dienimidamide
6,6-dinitrohexa-3,5-dienimidamide (PubChem CID 91235769) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is 6,6-dinitrohexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | 6,6-dinitrohexa-3,5-dienimidamide |
| PubChem CID | 91235769 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 6,6-dinitrohexa-3,5-dienimidamide |
| SMILES | [H]/N=C(\N)CC=CC=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N4O4/c7-5(8)3-1-2-4-6(9(11)12)10(13)14/h1-2,4H,3H2,(H3,7,8) |
| InChIKey | PPDSKFGDFCLFOS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dinitrohexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dinitrohexa-3,5-dienimidamide?
The IUPAC name of 6,6-dinitrohexa-3,5-dienimidamide (CID 91235769) is 6,6-dinitrohexa-3,5-dienimidamide.
What is the SMILES notation for 6,6-dinitrohexa-3,5-dienimidamide?
The canonical SMILES for 6,6-dinitrohexa-3,5-dienimidamide is [H]/N=C(\N)CC=CC=C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 6,6-dinitrohexa-3,5-dienimidamide?
The InChIKey is PPDSKFGDFCLFOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4/c7-5(8)3-1-2-4-6(9(11)12)10(13)14/h1-2,4H,3H2,(H3,7,8).
What are the key properties of 6,6-dinitrohexa-3,5-dienimidamide?
6,6-dinitrohexa-3,5-dienimidamide has a molecular weight of 200.15 g/mol, XLogP of 0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dinitrohexa-3,5-dienimidamide is sourced from PubChem (CID 91235769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).