About 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid
2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid (PubChem CID 91235811) has the molecular formula C20H20FNO4
and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid |
| PubChem CID | 91235811 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid |
| SMILES | CCC(NC(=O)C(C(C)=O)c1cccc(F)c1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H20FNO4/c1-3-16(13-8-5-4-6-9-13)22-19(24)17(12(2)23)14-10-7-11-15(21)18(14)20(25)26/h4-11,16-17H,3H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | WIJXDFUASCWUKI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid?
The IUPAC name of 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid (CID 91235811) is 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid.
What is the SMILES notation for 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid?
The canonical SMILES for 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid is CCC(NC(=O)C(C(C)=O)c1cccc(F)c1C(=O)O)c1ccccc1.
What is the InChIKey of 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid?
The InChIKey is WIJXDFUASCWUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO4/c1-3-16(13-8-5-4-6-9-13)22-19(24)17(12(2)23)14-10-7-11-15(21)18(14)20(25)26/h4-11,16-17H,3H2,1-2H3,(H,22,24)(H,25,26).
What are the key properties of 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid?
2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid has a molecular weight of 357.38 g/mol, XLogP of 3.46, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-dioxo-1-(1-phenylpropylamino)butan-2-yl]-6-fluorobenzoic acid is sourced from PubChem (CID 91235811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).