C9H14ClN4O3PS — CID 91235978
[2-amino-4-chloro-7-(phosphanylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl methanesulfonate (PubChem CID 91235978) has the molecular formula C9H14ClN4O3PS and a molecular weight of 324.73 g/mol. Its IUPAC name is [2-amino-4-chloro-7-(phosphanylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl methanesulfonate.
| Compound Name | [2-amino-4-chloro-7-(phosphanylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 91235978 |
| Molecular Formula | C9H14ClN4O3PS |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [2-amino-4-chloro-7-(phosphanylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CN(CP)c2nc(N)nc(Cl)c21 |
| InChI | InChI=1S/C9H14ClN4O3PS/c1-19(15,16)17-3-5-2-14(4-18)8-6(5)7(10)12-9(11)13-8/h5H,2-4,18H2,1H3,(H2,11,12,13) |
| InChIKey | AHPRNNNEYQNDLQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|