About 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one
2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one (PubChem CID 91236849) has the molecular formula C28H34N2O2
and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one |
| PubChem CID | 91236849 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one |
| SMILES | CCCCc1nc(=O)c(CC(=O)C(C)(C)C)c(C)n1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H34N2O2/c1-6-7-16-26-29-27(32)24(18-25(31)28(3,4)5)20(2)30(26)19-21-12-11-15-23(17-21)22-13-9-8-10-14-22/h8-15,17H,6-7,16,18-19H2,1-5H3 |
| InChIKey | QOVQKJUOEFTMIZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one?
The IUPAC name of 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one (CID 91236849) is 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one.
What is the SMILES notation for 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one?
The canonical SMILES for 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one is CCCCc1nc(=O)c(CC(=O)C(C)(C)C)c(C)n1Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one?
The InChIKey is QOVQKJUOEFTMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O2/c1-6-7-16-26-29-27(32)24(18-25(31)28(3,4)5)20(2)30(26)19-21-12-11-15-23(17-21)22-13-9-8-10-14-22/h8-15,17H,6-7,16,18-19H2,1-5H3.
What are the key properties of 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one?
2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one has a molecular weight of 430.59 g/mol, XLogP of 5.77, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-(3,3-dimethyl-2-oxobutyl)-6-methyl-1-[(3-phenylphenyl)methyl]pyrimidin-4-one is sourced from PubChem (CID 91236849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).