About 1-ethoxy-3,3-difluoroprop-1-ene
1-ethoxy-3,3-difluoroprop-1-ene (PubChem CID 91236862) has the molecular formula C5H8F2O
and a molecular weight of 122.11 g/mol. Its IUPAC name is 1-ethoxy-3,3-difluoroprop-1-ene.
Molecular Properties
| Compound Name | 1-ethoxy-3,3-difluoroprop-1-ene |
| PubChem CID | 91236862 |
| Molecular Formula | C5H8F2O |
| Molecular Weight | 122.11 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1-ethoxy-3,3-difluoroprop-1-ene |
| SMILES | CCOC=CC(F)F |
| InChI | InChI=1S/C5H8F2O/c1-2-8-4-3-5(6)7/h3-5H,2H2,1H3 |
| InChIKey | SMLMKVOBRDKBNW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.11 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-3,3-difluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-3,3-difluoroprop-1-ene?
The IUPAC name of 1-ethoxy-3,3-difluoroprop-1-ene (CID 91236862) is 1-ethoxy-3,3-difluoroprop-1-ene.
What is the SMILES notation for 1-ethoxy-3,3-difluoroprop-1-ene?
The canonical SMILES for 1-ethoxy-3,3-difluoroprop-1-ene is CCOC=CC(F)F.
What is the InChIKey of 1-ethoxy-3,3-difluoroprop-1-ene?
The InChIKey is SMLMKVOBRDKBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2O/c1-2-8-4-3-5(6)7/h3-5H,2H2,1H3.
What are the key properties of 1-ethoxy-3,3-difluoroprop-1-ene?
1-ethoxy-3,3-difluoroprop-1-ene has a molecular weight of 122.11 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-3,3-difluoroprop-1-ene is sourced from PubChem (CID 91236862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).