C17H21FN6O3 — CID 91236871
2-amino-4-cyclopropyl-7-fluoro-6-[3-imino-4-(methoxyamino)pyrrolidin-1-yl]-5-methylpyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 91236871) has the molecular formula C17H21FN6O3 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-amino-4-cyclopropyl-7-fluoro-6-[3-imino-4-(methoxyamino)pyrrolidin-1-yl]-5-methylpyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 2-amino-4-cyclopropyl-7-fluoro-6-[3-imino-4-(methoxyamino)pyrrolidin-1-yl]-5-methylpyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 91236871 |
| Molecular Formula | C17H21FN6O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-amino-4-cyclopropyl-7-fluoro-6-[3-imino-4-(methoxyamino)pyrrolidin-1-yl]-5-methylpyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | [H]/N=C1\CN(c2c(F)cn3c(=O)n(N)c(=O)c(C4CC4)c3c2C)CC1NOC |
| InChI | InChI=1S/C17H21FN6O3/c1-8-14(22-6-11(19)12(7-22)21-27-2)10(18)5-23-15(8)13(9-3-4-9)16(25)24(20)17(23)26/h5,9,12,19,21H,3-4,6-7,20H2,1-2H3/b19-11+ |
| InChIKey | DQYKARSLZANLNS-YBFXNURJSA-N |
| XLogP | -0.14 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|