C40H42FN3O9S — CID 91237049
tert-butyl 3-[4-[[3-[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]-2-fluorophenyl]propanoate (PubChem CID 91237049) has the molecular formula C40H42FN3O9S and a molecular weight of 759.85 g/mol. Its IUPAC name is tert-butyl 3-[4-[[3-[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]-2-fluorophenyl]propanoate.
| Compound Name | tert-butyl 3-[4-[[3-[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 91237049 |
| Molecular Formula | C40H42FN3O9S |
| Molecular Weight | 759.85 g/mol |
| Exact Mass | 759.26 |
| IUPAC Name | tert-butyl 3-[4-[[3-[4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]-2-fluorophenyl]propanoate |
| SMILES | Cc1cc(OCCn2c(O)ccc2O)cc(C)c1-c1cccc(CN(c2ccc(CCC(=O)OC(C)(C)C)c(F)c2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C40H42FN3O9S/c1-26-21-32(52-20-19-42-36(45)16-17-37(42)46)22-27(2)39(26)30-10-8-9-28(23-30)25-43(54(50,51)35-12-7-6-11-34(35)44(48)49)31-15-13-29(33(41)24-31)14-18-38(47)53-40(3,4)5/h6-13,15-17,21-24,45-46H,14,18-20,25H2,1-5H3 |
| InChIKey | LPNSBCBZGNPBTI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.85 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|