About 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea
1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea (PubChem CID 91237236) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea |
| PubChem CID | 91237236 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea |
| SMILES | CNC(=O)NC1=NC(O)CC(C)=N1 |
| InChI | InChI=1S/C7H12N4O2/c1-4-3-5(12)10-6(9-4)11-7(13)8-2/h5,12H,3H2,1-2H3,(H2,8,10,11,13) |
| InChIKey | HTOVOLBWYKZVBP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea?
The IUPAC name of 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea (CID 91237236) is 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea.
What is the SMILES notation for 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea?
The canonical SMILES for 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea is CNC(=O)NC1=NC(O)CC(C)=N1.
What is the InChIKey of 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea?
The InChIKey is HTOVOLBWYKZVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-4-3-5(12)10-6(9-4)11-7(13)8-2/h5,12H,3H2,1-2H3,(H2,8,10,11,13).
What are the key properties of 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea?
1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea has a molecular weight of 184.20 g/mol, XLogP of -0.55, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-6-methyl-4,5-dihydropyrimidin-2-yl)-3-methylurea is sourced from PubChem (CID 91237236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).