C25H25NO — CID 91237329
5-spiro[3H-1-benzofuran-2,2'-adamantane]-5-yl-1H-indole (PubChem CID 91237329) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 5-spiro[3H-1-benzofuran-2,2'-adamantane]-5-yl-1H-indole.
| Compound Name | 5-spiro[3H-1-benzofuran-2,2'-adamantane]-5-yl-1H-indole |
|---|---|
| PubChem CID | 91237329 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 5-spiro[3H-1-benzofuran-2,2'-adamantane]-5-yl-1H-indole |
| SMILES | c1cc2cc(-c3ccc4c(c3)CC3(O4)C4CC5CC(C4)CC3C5)ccc2[nH]1 |
| InChI | InChI=1S/C25H25NO/c1-3-23-19(5-6-26-23)12-17(1)18-2-4-24-20(13-18)14-25(27-24)21-8-15-7-16(10-21)11-22(25)9-15/h1-6,12-13,15-16,21-22,26H,7-11,14H2 |
| InChIKey | PYDDTBLXOQWZHO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |