About N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine
N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine (PubChem CID 91237668) has the molecular formula C10H19F3N2
and a molecular weight of 224.27 g/mol. Its IUPAC name is N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine |
| PubChem CID | 91237668 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine |
| SMILES | CCN(C)C1CCC(C(F)(F)F)CN1C |
| InChI | InChI=1S/C10H19F3N2/c1-4-14(2)9-6-5-8(7-15(9)3)10(11,12)13/h8-9H,4-7H2,1-3H3 |
| InChIKey | OYOQTSCQJLXDEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine?
The IUPAC name of N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine (CID 91237668) is N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine.
What is the SMILES notation for N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine?
The canonical SMILES for N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine is CCN(C)C1CCC(C(F)(F)F)CN1C.
What is the InChIKey of N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine?
The InChIKey is OYOQTSCQJLXDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2/c1-4-14(2)9-6-5-8(7-15(9)3)10(11,12)13/h8-9H,4-7H2,1-3H3.
What are the key properties of N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine?
N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine has a molecular weight of 224.27 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,1-dimethyl-5-(trifluoromethyl)piperidin-2-amine is sourced from PubChem (CID 91237668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).