About fluoro 2-methylbut-2-enoate
fluoro 2-methylbut-2-enoate (PubChem CID 91237784) has the molecular formula C5H7FO2
and a molecular weight of 118.11 g/mol. Its IUPAC name is fluoro 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | fluoro 2-methylbut-2-enoate |
| PubChem CID | 91237784 |
| Molecular Formula | C5H7FO2 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | fluoro 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OF |
| InChI | InChI=1S/C5H7FO2/c1-3-4(2)5(7)8-6/h3H,1-2H3 |
| InChIKey | JOWGDEBSSZOIBI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze fluoro 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-methylbut-2-enoate?
The IUPAC name of fluoro 2-methylbut-2-enoate (CID 91237784) is fluoro 2-methylbut-2-enoate.
What is the SMILES notation for fluoro 2-methylbut-2-enoate?
The canonical SMILES for fluoro 2-methylbut-2-enoate is CC=C(C)C(=O)OF.
What is the InChIKey of fluoro 2-methylbut-2-enoate?
The InChIKey is JOWGDEBSSZOIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO2/c1-3-4(2)5(7)8-6/h3H,1-2H3.
What are the key properties of fluoro 2-methylbut-2-enoate?
fluoro 2-methylbut-2-enoate has a molecular weight of 118.11 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-methylbut-2-enoate is sourced from PubChem (CID 91237784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).