C16H15N3O4 — CID 912385
3-pyridin-2-yl-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 912385) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-pyridin-2-yl-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-pyridin-2-yl-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 912385 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-pyridin-2-yl-5-(2,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(OC)c(-c2nc(-c3ccccn3)no2)cc1OC |
| InChI | InChI=1S/C16H15N3O4/c1-20-12-9-14(22-3)13(21-2)8-10(12)16-18-15(19-23-16)11-6-4-5-7-17-11/h4-9H,1-3H3 |
| InChIKey | MNGVOAOTHJDKDF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |