C30H44O4 — CID 91238867
[(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylpent-2-enyl] propanoate (PubChem CID 91238867) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is [(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylpent-2-enyl] propanoate.
| Compound Name | [(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylpent-2-enyl] propanoate |
|---|---|
| PubChem CID | 91238867 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | [(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylpent-2-enyl] propanoate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)C=C[C@@H](OC(=O)CC)C4CC4)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H44O4/c1-5-29(33)34-28(22-10-11-22)15-8-19(2)25-13-14-26-21(7-6-16-30(25,26)4)9-12-23-17-24(31)18-27(32)20(23)3/h8-9,12,15,19,22,24-28,31-32H,3,5-7,10-11,13-14,16-18H2,1-2,4H3/t19-,24-,25-,26+,27+,28-,30-/m1/s1 |
| InChIKey | PDAGVLILOIOYMY-AVGGXEHISA-N |
| XLogP | 6.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|