C17H23F3N2O2 — CID 91239041
tert-butyl N-[1-[4-[N-ethyl-C-(trifluoromethyl)carbonimidoyl]phenyl]ethyl]carbamate (PubChem CID 91239041) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[N-ethyl-C-(trifluoromethyl)carbonimidoyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[N-ethyl-C-(trifluoromethyl)carbonimidoyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91239041 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl N-[1-[4-[N-ethyl-C-(trifluoromethyl)carbonimidoyl]phenyl]ethyl]carbamate |
| SMILES | CC/N=C(\c1ccc(C(C)NC(=O)OC(C)(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O2/c1-6-21-14(17(18,19)20)13-9-7-12(8-10-13)11(2)22-15(23)24-16(3,4)5/h7-11H,6H2,1-5H3,(H,22,23)/b21-14+ |
| InChIKey | PDIYIQNVWCQVJA-KGENOOAVSA-N |
| XLogP | 4.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|