About N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine
N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine (PubChem CID 91240405) has the molecular formula C17H27FN2
and a molecular weight of 278.42 g/mol. Its IUPAC name is N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine.
Molecular Properties
| Compound Name | N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine |
| PubChem CID | 91240405 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine |
| SMILES | CC=CC1(N(C)C2C=C(F)C=CC2)CCNC(C)CC1 |
| InChI | InChI=1S/C17H27FN2/c1-4-9-17(10-8-14(2)19-12-11-17)20(3)16-7-5-6-15(18)13-16/h4-6,9,13-14,16,19H,7-8,10-12H2,1-3H3 |
| InChIKey | MCPNCPJGEOMZHU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine?
The IUPAC name of N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine (CID 91240405) is N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine.
What is the SMILES notation for N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine?
The canonical SMILES for N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine is CC=CC1(N(C)C2C=C(F)C=CC2)CCNC(C)CC1.
What is the InChIKey of N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine?
The InChIKey is MCPNCPJGEOMZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FN2/c1-4-9-17(10-8-14(2)19-12-11-17)20(3)16-7-5-6-15(18)13-16/h4-6,9,13-14,16,19H,7-8,10-12H2,1-3H3.
What are the key properties of N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine?
N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine has a molecular weight of 278.42 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorocyclohexa-2,4-dien-1-yl)-N,7-dimethyl-4-prop-1-enylazepan-4-amine is sourced from PubChem (CID 91240405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).