C8H13NO2 — CID 91240622
7-methylidene-3,4a,5,6,8,8a-hexahydro-2H-[1,4]dioxino[2,3-b]pyridine (PubChem CID 91240622) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 7-methylidene-3,4a,5,6,8,8a-hexahydro-2H-[1,4]dioxino[2,3-b]pyridine.
| Compound Name | 7-methylidene-3,4a,5,6,8,8a-hexahydro-2H-[1,4]dioxino[2,3-b]pyridine |
|---|---|
| PubChem CID | 91240622 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 7-methylidene-3,4a,5,6,8,8a-hexahydro-2H-[1,4]dioxino[2,3-b]pyridine |
| SMILES | C=C1CNC2OCCOC2C1 |
| InChI | InChI=1S/C8H13NO2/c1-6-4-7-8(9-5-6)11-3-2-10-7/h7-9H,1-5H2 |
| InChIKey | SCAGYBQYPTWZQG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|