About 2H-pyrazino[2,3-h][3]benzazepine
2H-pyrazino[2,3-h][3]benzazepine (PubChem CID 91240707) has the molecular formula C12H9N3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2H-pyrazino[2,3-h][3]benzazepine.
Molecular Properties
| Compound Name | 2H-pyrazino[2,3-h][3]benzazepine |
| PubChem CID | 91240707 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2H-pyrazino[2,3-h][3]benzazepine |
| SMILES | C1=Cc2cc3c(cc2=CC=N1)N=CCN=3 |
| InChI | InChI=1S/C12H9N3/c1-3-13-4-2-10-8-12-11(7-9(1)10)14-5-6-15-12/h1-5,7-8H,6H2 |
| InChIKey | FNQNPXKMAIUACR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-pyrazino[2,3-h][3]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrazino[2,3-h][3]benzazepine?
The IUPAC name of 2H-pyrazino[2,3-h][3]benzazepine (CID 91240707) is 2H-pyrazino[2,3-h][3]benzazepine.
What is the SMILES notation for 2H-pyrazino[2,3-h][3]benzazepine?
The canonical SMILES for 2H-pyrazino[2,3-h][3]benzazepine is C1=Cc2cc3c(cc2=CC=N1)N=CCN=3.
What is the InChIKey of 2H-pyrazino[2,3-h][3]benzazepine?
The InChIKey is FNQNPXKMAIUACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3/c1-3-13-4-2-10-8-12-11(7-9(1)10)14-5-6-15-12/h1-5,7-8H,6H2.
What are the key properties of 2H-pyrazino[2,3-h][3]benzazepine?
2H-pyrazino[2,3-h][3]benzazepine has a molecular weight of 195.22 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrazino[2,3-h][3]benzazepine is sourced from PubChem (CID 91240707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).