C10H15NO2S — CID 91240775
N,5,5-trimethylcyclohepta-1,3,6-triene-1-sulfonamide (PubChem CID 91240775) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is N,5,5-trimethylcyclohepta-1,3,6-triene-1-sulfonamide.
| Compound Name | N,5,5-trimethylcyclohepta-1,3,6-triene-1-sulfonamide |
|---|---|
| PubChem CID | 91240775 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N,5,5-trimethylcyclohepta-1,3,6-triene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1=CC=CC(C)(C)C=C1 |
| InChI | InChI=1S/C10H15NO2S/c1-10(2)7-4-5-9(6-8-10)14(12,13)11-3/h4-8,11H,1-3H3 |
| InChIKey | YQLQJVRJKYLITE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |