C25H33N3O6S — CID 91241728
3-[2-[cyclopropylmethoxy(formamido)methyl]-4-[2-(5-methyl-2-morpholin-4-yl-1,3-thiazol-4-yl)ethoxy]phenyl]propanoic acid (PubChem CID 91241728) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is 3-[2-[cyclopropylmethoxy(formamido)methyl]-4-[2-(5-methyl-2-morpholin-4-yl-1,3-thiazol-4-yl)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[cyclopropylmethoxy(formamido)methyl]-4-[2-(5-methyl-2-morpholin-4-yl-1,3-thiazol-4-yl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91241728 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-[2-[cyclopropylmethoxy(formamido)methyl]-4-[2-(5-methyl-2-morpholin-4-yl-1,3-thiazol-4-yl)ethoxy]phenyl]propanoic acid |
| SMILES | Cc1sc(N2CCOCC2)nc1CCOc1ccc(CCC(=O)O)c(C(NC=O)OCC2CC2)c1 |
| InChI | InChI=1S/C25H33N3O6S/c1-17-22(27-25(35-17)28-9-12-32-13-10-28)8-11-33-20-6-4-19(5-7-23(30)31)21(14-20)24(26-16-29)34-15-18-2-3-18/h4,6,14,16,18,24H,2-3,5,7-13,15H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | VDLSSANZVFWCRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|