About 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene
2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene (PubChem CID 91241824) has the molecular formula C9H14S
and a molecular weight of 154.28 g/mol. Its IUPAC name is 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 91241824 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene |
| SMILES | CSC1=C(C)C=CCC1C |
| InChI | InChI=1S/C9H14S/c1-7-5-4-6-8(2)9(7)10-3/h4-5,8H,6H2,1-3H3 |
| InChIKey | MYHMHSBWEIOIHY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene (CID 91241824) is 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene is CSC1=C(C)C=CCC1C.
What is the InChIKey of 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The InChIKey is MYHMHSBWEIOIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S/c1-7-5-4-6-8(2)9(7)10-3/h4-5,8H,6H2,1-3H3.
What are the key properties of 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene has a molecular weight of 154.28 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 91241824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).