About methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate
methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate (PubChem CID 91241909) has the molecular formula C28H27NO5
and a molecular weight of 457.53 g/mol. Its IUPAC name is methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate |
| PubChem CID | 91241909 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2cccc(-c3cccc(Cn4c(O)ccc4O)c3)c2)cc1 |
| InChI | InChI=1S/C28H27NO5/c1-33-28(32)15-10-20-8-11-25(12-9-20)34-19-22-5-3-7-24(17-22)23-6-2-4-21(16-23)18-29-26(30)13-14-27(29)31/h2-9,11-14,16-17,30-31H,10,15,18-19H2,1H3 |
| InChIKey | YPRIGGHVZFITFB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate?
The IUPAC name of methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate (CID 91241909) is methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate.
What is the SMILES notation for methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate?
The canonical SMILES for methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate is COC(=O)CCc1ccc(OCc2cccc(-c3cccc(Cn4c(O)ccc4O)c3)c2)cc1.
What is the InChIKey of methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate?
The InChIKey is YPRIGGHVZFITFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27NO5/c1-33-28(32)15-10-20-8-11-25(12-9-20)34-19-22-5-3-7-24(17-22)23-6-2-4-21(16-23)18-29-26(30)13-14-27(29)31/h2-9,11-14,16-17,30-31H,10,15,18-19H2,1H3.
What are the key properties of methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate?
methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate has a molecular weight of 457.53 g/mol, XLogP of 5.30, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[[3-[3-[(2,5-dihydroxypyrrol-1-yl)methyl]phenyl]phenyl]methoxy]phenyl]propanoate is sourced from PubChem (CID 91241909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).