About CID 91242215
CID 91242215 (PubChem CID 91242215) has the molecular formula C5H8BN
and a molecular weight of 92.94 g/mol.
Molecular Properties
| Compound Name | CID 91242215 |
| PubChem CID | 91242215 |
| Molecular Formula | C5H8BN |
| Molecular Weight | 92.94 g/mol |
| Exact Mass | 93.07 |
| IUPAC Name | — |
| SMILES | [B]N=C(C)C(=C)C |
| InChI | InChI=1S/C5H8BN/c1-4(2)5(3)7-6/h1H2,2-3H3 |
| InChIKey | ZFSUGCGWXPSJHJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.94 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 91242215 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91242215?
The IUPAC name of CID 91242215 (CID 91242215) is not available.
What is the SMILES notation for CID 91242215?
The canonical SMILES for CID 91242215 is [B]N=C(C)C(=C)C.
What is the InChIKey of CID 91242215?
The InChIKey is ZFSUGCGWXPSJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BN/c1-4(2)5(3)7-6/h1H2,2-3H3.
What are the key properties of CID 91242215?
CID 91242215 has a molecular weight of 92.94 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91242215 is sourced from PubChem (CID 91242215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).