About [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate
[2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate (PubChem CID 91242505) has the molecular formula C17H21F2NO7S
and a molecular weight of 421.42 g/mol. Its IUPAC name is [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate |
| PubChem CID | 91242505 |
| Molecular Formula | C17H21F2NO7S |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)On1c(O)ccc1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H21F2NO7S/c18-17(19,28(24,25)27-20-13(21)1-2-14(20)22)9-26-15(23)16-6-10-3-11(7-16)5-12(4-10)8-16/h1-2,10-12,21-22H,3-9H2 |
| InChIKey | WLTDPBBRKGPBSN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate?
The IUPAC name of [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate (CID 91242505) is [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate.
What is the SMILES notation for [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate?
The canonical SMILES for [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate is O=C(OCC(F)(F)S(=O)(=O)On1c(O)ccc1O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate?
The InChIKey is WLTDPBBRKGPBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO7S/c18-17(19,28(24,25)27-20-13(21)1-2-14(20)22)9-26-15(23)16-6-10-3-11(7-16)5-12(4-10)8-16/h1-2,10-12,21-22H,3-9H2.
What are the key properties of [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate?
[2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate has a molecular weight of 421.42 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dihydroxypyrrol-1-yl)oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate is sourced from PubChem (CID 91242505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).