C15H20F6O4 — CID 91242756
2-(2-ethylhexyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid (PubChem CID 91242756) has the molecular formula C15H20F6O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid.
| Compound Name | 2-(2-ethylhexyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 91242756 |
| Molecular Formula | C15H20F6O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(2-ethylhexyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid |
| SMILES | CCCCC(CC)CC(C(=O)O)=C(C(=O)O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O4/c1-3-5-6-8(4-2)7-9(12(22)23)10(13(24)25)11(14(16,17)18)15(19,20)21/h8,11H,3-7H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | HVSGGCKAINFXFS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|