C22H29N3O5S — CID 91243243
(3R)-3-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-N-hydroxy-3-pyridin-2-ylpropanamide (PubChem CID 91243243) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is (3R)-3-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-N-hydroxy-3-pyridin-2-ylpropanamide.
| Compound Name | (3R)-3-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-N-hydroxy-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 91243243 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3R)-3-[4-[(2,5-dimethylphenyl)methoxy]piperidin-1-yl]sulfonyl-N-hydroxy-3-pyridin-2-ylpropanamide |
| SMILES | Cc1ccc(C)c(COC2CCN(S(=O)(=O)[C@H](CC(=O)NO)c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-16-6-7-17(2)18(13-16)15-30-19-8-11-25(12-9-19)31(28,29)21(14-22(26)24-27)20-5-3-4-10-23-20/h3-7,10,13,19,21,27H,8-9,11-12,14-15H2,1-2H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | LGCBXSGZKBIHKO-OAQYLSRUSA-N |
| XLogP | 2.65 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|