C12H13BrN2O2 — CID 91244004
4-(bromomethyl)-5-cyano-2-(ethoxymethyl)benzamide (PubChem CID 91244004) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 4-(bromomethyl)-5-cyano-2-(ethoxymethyl)benzamide.
| Compound Name | 4-(bromomethyl)-5-cyano-2-(ethoxymethyl)benzamide |
|---|---|
| PubChem CID | 91244004 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-(bromomethyl)-5-cyano-2-(ethoxymethyl)benzamide |
| SMILES | CCOCc1cc(CBr)c(C#N)cc1C(N)=O |
| InChI | InChI=1S/C12H13BrN2O2/c1-2-17-7-10-3-8(5-13)9(6-14)4-11(10)12(15)16/h3-4H,2,5,7H2,1H3,(H2,15,16) |
| InChIKey | MUVUJGKHQPAZLA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|