C17H31NO2 — CID 91244271
N-[(1S)-1-[(1R,2S,4S)-2-ethenyl-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide (PubChem CID 91244271) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2S,4S)-2-ethenyl-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide.
| Compound Name | N-[(1S)-1-[(1R,2S,4S)-2-ethenyl-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide |
|---|---|
| PubChem CID | 91244271 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[(1S)-1-[(1R,2S,4S)-2-ethenyl-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide |
| SMILES | C=C[C@@H]1C[C@H](CO)C[C@H]1[C@H](CC(CC)CC)NC(C)=O |
| InChI | InChI=1S/C17H31NO2/c1-5-13(6-2)10-17(18-12(4)20)16-9-14(11-19)8-15(16)7-3/h7,13-17,19H,3,5-6,8-11H2,1-2,4H3,(H,18,20)/t14-,15+,16+,17-/m0/s1 |
| InChIKey | YZSGTSMNHREIMS-HZMVEIRTSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|