C25H27FO3 — CID 91244401
3-[2-ethyl-5-(4-fluorophenoxy)phenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 91244401) has the molecular formula C25H27FO3 and a molecular weight of 394.49 g/mol. Its IUPAC name is 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91244401 |
| Molecular Formula | C25H27FO3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc(F)cc2)cc1C1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C25H27FO3/c1-5-15-6-9-18(29-17-10-7-16(26)8-11-17)14-19(15)21-22(27)20-12-13-25(4,23(21)28)24(20,2)3/h6-11,14,20-21H,5,12-13H2,1-4H3 |
| InChIKey | WUOPULPOAFKRDR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|