C11H16N4O3 — CID 9124455
ethyl 1-(3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxylate (PubChem CID 9124455) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 1-(3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9124455 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | ethyl 1-(3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cn[nH]c(=O)n2)CC1 |
| InChI | InChI=1S/C11H16N4O3/c1-2-18-10(16)8-3-5-15(6-4-8)9-7-12-14-11(17)13-9/h7-8H,2-6H2,1H3,(H,13,14,17) |
| InChIKey | PKUADNWOACSFMW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |