C22H23ClN5O4S+ — CID 91244712
(1R)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(cyanomethyl)-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1-carboxamide (PubChem CID 91244712) has the molecular formula C22H23ClN5O4S+ and a molecular weight of 488.98 g/mol. Its IUPAC name is (1R)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(cyanomethyl)-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (1R)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(cyanomethyl)-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91244712 |
| Molecular Formula | C22H23ClN5O4S+ |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (1R)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(cyanomethyl)-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1-carboxamide |
| SMILES | N#CC[N@@+]1(C(=O)Nc2ccc(N3CCOCC3=O)cc2)CCC(NC(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C22H22ClN5O4S/c23-19-6-5-18(33-19)21(30)25-16-7-10-28(13-16,11-8-24)22(31)26-15-1-3-17(4-2-15)27-9-12-32-14-20(27)29/h1-6,16H,7,9-14H2,(H-,25,26,30,31)/p+1/t16?,28-/m0/s1 |
| InChIKey | WUPFMTZSTRQDGM-HJLWYHJMSA-O |
| XLogP | 2.84 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|