C23H33N7O4S2 — CID 91244954
4-[[5-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-2,3-dihydro-1H-imidazo[4,5-b]pyrazin-6-yl]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide (PubChem CID 91244954) has the molecular formula C23H33N7O4S2 and a molecular weight of 535.70 g/mol. Its IUPAC name is 4-[[5-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-2,3-dihydro-1H-imidazo[4,5-b]pyrazin-6-yl]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide.
| Compound Name | 4-[[5-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-2,3-dihydro-1H-imidazo[4,5-b]pyrazin-6-yl]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91244954 |
| Molecular Formula | C23H33N7O4S2 |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 4-[[5-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-2,3-dihydro-1H-imidazo[4,5-b]pyrazin-6-yl]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1scc(Nc2nc3c(nc2N[C@@H](c2ccc(C)o2)C(C)(C)C)NCN3)c1O |
| InChI | InChI=1S/C23H33N7O4S2/c1-7-30(8-2)36(32,33)22-16(31)14(11-35-22)26-20-21(29-19-18(28-20)24-12-25-19)27-17(23(4,5)6)15-10-9-13(3)34-15/h9-11,17,31H,7-8,12H2,1-6H3,(H2,24,26,28)(H2,25,27,29)/t17-/m0/s1 |
| InChIKey | ILKVWSCQCACXFQ-KRWDZBQOSA-N |
| XLogP | 4.91 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|