About 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine
3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine (PubChem CID 91245189) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine.
Molecular Properties
| Compound Name | 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine |
| PubChem CID | 91245189 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine |
| SMILES | CC=CC1NC(=O)C1CC.CN1CCC1 |
| InChI | InChI=1S/C8H13NO.C4H9N/c1-3-5-7-6(4-2)8(10)9-7;1-5-3-2-4-5/h3,5-7H,4H2,1-2H3,(H,9,10);2-4H2,1H3 |
| InChIKey | XRAGTKJGTRQUBL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine?
The IUPAC name of 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine (CID 91245189) is 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine.
What is the SMILES notation for 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine?
The canonical SMILES for 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine is CC=CC1NC(=O)C1CC.CN1CCC1.
What is the InChIKey of 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine?
The InChIKey is XRAGTKJGTRQUBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C4H9N/c1-3-5-7-6(4-2)8(10)9-7;1-5-3-2-4-5/h3,5-7H,4H2,1-2H3,(H,9,10);2-4H2,1H3.
What are the key properties of 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine?
3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine has a molecular weight of 210.32 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-prop-1-enylazetidin-2-one;1-methylazetidine is sourced from PubChem (CID 91245189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).