C14H16O10S — CID 91245222
[(2R,3R,4S,5S)-3,5-bis(ethenoxycarbonyloxy)-2-hydroxythian-4-yl] ethenyl carbonate (PubChem CID 91245222) has the molecular formula C14H16O10S and a molecular weight of 376.34 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,5-bis(ethenoxycarbonyloxy)-2-hydroxythian-4-yl] ethenyl carbonate.
| Compound Name | [(2R,3R,4S,5S)-3,5-bis(ethenoxycarbonyloxy)-2-hydroxythian-4-yl] ethenyl carbonate |
|---|---|
| PubChem CID | 91245222 |
| Molecular Formula | C14H16O10S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [(2R,3R,4S,5S)-3,5-bis(ethenoxycarbonyloxy)-2-hydroxythian-4-yl] ethenyl carbonate |
| SMILES | C=COC(=O)O[C@@H]1[C@@H](OC(=O)OC=C)[C@H](OC(=O)OC=C)CS[C@H]1O |
| InChI | InChI=1S/C14H16O10S/c1-4-19-12(16)22-8-7-25-11(15)10(24-14(18)21-6-3)9(8)23-13(17)20-5-2/h4-6,8-11,15H,1-3,7H2/t8-,9+,10-,11-/m1/s1 |
| InChIKey | UQEFTPZMQFAALK-LMLFDSFASA-N |
| XLogP | 2.05 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|