C15H21N3O5 — CID 91245671
(2R)-2-[(2-amino-2-methylpropanoyl)amino]-3-(2-carbamoylphenyl)-2-methoxypropanoic acid (PubChem CID 91245671) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-2-[(2-amino-2-methylpropanoyl)amino]-3-(2-carbamoylphenyl)-2-methoxypropanoic acid.
| Compound Name | (2R)-2-[(2-amino-2-methylpropanoyl)amino]-3-(2-carbamoylphenyl)-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 91245671 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R)-2-[(2-amino-2-methylpropanoyl)amino]-3-(2-carbamoylphenyl)-2-methoxypropanoic acid |
| SMILES | CO[C@@](Cc1ccccc1C(N)=O)(NC(=O)C(C)(C)N)C(=O)O |
| InChI | InChI=1S/C15H21N3O5/c1-14(2,17)12(20)18-15(23-3,13(21)22)8-9-6-4-5-7-10(9)11(16)19/h4-7H,8,17H2,1-3H3,(H2,16,19)(H,18,20)(H,21,22)/t15-/m1/s1 |
| InChIKey | FTPDHVGOEHICSK-OAHLLOKOSA-N |
| XLogP | -0.39 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|