About deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine
deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine (PubChem CID 91245726) has the molecular formula C12H27N
and a molecular weight of 186.36 g/mol. Its IUPAC name is deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine.
Molecular Properties
| Compound Name | deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine |
| PubChem CID | 91245726 |
| Molecular Formula | C12H27N |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.22 |
| IUPAC Name | deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine |
| SMILES | CC.CC(C)=C1CCN(C)CC1.[2H]C |
| InChI | InChI=1S/C9H17N.C2H6.CH4/c1-8(2)9-4-6-10(3)7-5-9;1-2;/h4-7H2,1-3H3;1-2H3;1H4/i;;1D |
| InChIKey | KVZNJRVOJZTMQS-PRQZKWGPSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine?
The IUPAC name of deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine (CID 91245726) is deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine.
What is the SMILES notation for deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine?
The canonical SMILES for deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine is CC.CC(C)=C1CCN(C)CC1.[2H]C.
What is the InChIKey of deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine?
The InChIKey is KVZNJRVOJZTMQS-PRQZKWGPSA-N. The full InChI is InChI=1S/C9H17N.C2H6.CH4/c1-8(2)9-4-6-10(3)7-5-9;1-2;/h4-7H2,1-3H3;1-2H3;1H4/i;;1D.
What are the key properties of deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine?
deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine has a molecular weight of 186.36 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;ethane;1-methyl-4-propan-2-ylidenepiperidine is sourced from PubChem (CID 91245726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).