C39H41ClN4O5 — CID 91245733
(4-methylphenyl) 1-[4-[3-butan-2-yloxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91245733) has the molecular formula C39H41ClN4O5 and a molecular weight of 681.23 g/mol. Its IUPAC name is (4-methylphenyl) 1-[4-[3-butan-2-yloxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) 1-[4-[3-butan-2-yloxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91245733 |
| Molecular Formula | C39H41ClN4O5 |
| Molecular Weight | 681.23 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | (4-methylphenyl) 1-[4-[3-butan-2-yloxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCC(C)OC(CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(C)cc2)cc1)CNC(=O)c1ccccn1 |
| InChI | InChI=1S/C39H41ClN4O5/c1-4-26(3)48-31(24-42-38(45)35-7-5-6-20-41-35)19-22-47-29-15-10-27(11-16-29)37-36-32(33-23-28(40)12-17-34(33)43-36)18-21-44(37)39(46)49-30-13-8-25(2)9-14-30/h5-17,20,23,26,31,37,43H,4,18-19,21-22,24H2,1-3H3,(H,42,45) |
| InChIKey | RREGMIZGGYIOEY-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.23 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|