ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate

C20H22O2S — CID 91245745

IUPACethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate
SMILESCC.CCOC(=O)C1=C(Sc2ccccc2)c2ccccc2C1
InChIInChI=1S/C18H16O2S.C2H6/c1-2-20-18(19)16-12-13-8-6-7-11-15(13)17(16)21-14-9-4-3-5-10-14;1-2/h3-11H,2,12H2,1H3;1-2H3
InChIKeyNDJPJCOQEUXBFT-UHFFFAOYSA-N
MW326.46 g/mol
LogP5.34
Rot. Bonds4

About ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate

ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate (PubChem CID 91245745) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate.

Molecular Properties

Compound Nameethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate
PubChem CID91245745
Molecular FormulaC20H22O2S
Molecular Weight326.46 g/mol
Exact Mass326.13
IUPAC Nameethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate
SMILESCC.CCOC(=O)C1=C(Sc2ccccc2)c2ccccc2C1
InChIInChI=1S/C18H16O2S.C2H6/c1-2-20-18(19)16-12-13-8-6-7-11-15(13)17(16)21-14-9-4-3-5-10-14;1-2/h3-11H,2,12H2,1H3;1-2H3
InChIKeyNDJPJCOQEUXBFT-UHFFFAOYSA-N
XLogP5.34
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500326.46
LogP ≤ 55.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate?
The IUPAC name of ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate (CID 91245745) is ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate.
What is the SMILES notation for ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate?
The canonical SMILES for ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate is CC.CCOC(=O)C1=C(Sc2ccccc2)c2ccccc2C1.
What is the InChIKey of ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate?
The InChIKey is NDJPJCOQEUXBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O2S.C2H6/c1-2-20-18(19)16-12-13-8-6-7-11-15(13)17(16)21-14-9-4-3-5-10-14;1-2/h3-11H,2,12H2,1H3;1-2H3.
What are the key properties of ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate?
ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate has a molecular weight of 326.46 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 3-phenylsulfanyl-1H-indene-2-carboxylate is sourced from PubChem (CID 91245745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).