C31H33ClF3N3O4S — CID 91245962
N-[5-(2-chloro-4-fluorophenyl)-4-[4-(3-hydroxypropoxy)phenyl]thiophene-2-carbonyl]-4-(4,4-difluoropiperidin-1-yl)piperidine-4-carboxamide (PubChem CID 91245962) has the molecular formula C31H33ClF3N3O4S and a molecular weight of 636.14 g/mol. Its IUPAC name is N-[5-(2-chloro-4-fluorophenyl)-4-[4-(3-hydroxypropoxy)phenyl]thiophene-2-carbonyl]-4-(4,4-difluoropiperidin-1-yl)piperidine-4-carboxamide.
| Compound Name | N-[5-(2-chloro-4-fluorophenyl)-4-[4-(3-hydroxypropoxy)phenyl]thiophene-2-carbonyl]-4-(4,4-difluoropiperidin-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91245962 |
| Molecular Formula | C31H33ClF3N3O4S |
| Molecular Weight | 636.14 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | N-[5-(2-chloro-4-fluorophenyl)-4-[4-(3-hydroxypropoxy)phenyl]thiophene-2-carbonyl]-4-(4,4-difluoropiperidin-1-yl)piperidine-4-carboxamide |
| SMILES | O=C(NC(=O)C1(N2CCC(F)(F)CC2)CCNCC1)c1cc(-c2ccc(OCCCO)cc2)c(-c2ccc(F)cc2Cl)s1 |
| InChI | InChI=1S/C31H33ClF3N3O4S/c32-25-18-21(33)4-7-23(25)27-24(20-2-5-22(6-3-20)42-17-1-16-39)19-26(43-27)28(40)37-29(41)30(8-12-36-13-9-30)38-14-10-31(34,35)11-15-38/h2-7,18-19,36,39H,1,8-17H2,(H,37,40,41) |
| InChIKey | JPISUDXSLXCMPC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.14 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|