C34H42ClN3O7 — CID 91246125
[(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3-phenylpropanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 91246125) has the molecular formula C34H42ClN3O7 and a molecular weight of 640.18 g/mol. Its IUPAC name is [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3-phenylpropanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3-phenylpropanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 91246125 |
| Molecular Formula | C34H42ClN3O7 |
| Molecular Weight | 640.18 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3-phenylpropanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | COC1=CC[C@@H]([C@@H](C)C=C(C)C=CC=CC(=O)N[C@@H](Cc2ccccc2)C(=O)NC=CC[C@H](CC=C(C)Cl)OC(N)=O)OC1=O |
| InChI | InChI=1S/C34H42ClN3O7/c1-23(21-24(2)29-18-19-30(43-4)33(41)45-29)11-8-9-15-31(39)38-28(22-26-12-6-5-7-13-26)32(40)37-20-10-14-27(44-34(36)42)17-16-25(3)35/h5-13,15-16,19-21,24,27-29H,14,17-18,22H2,1-4H3,(H2,36,42)(H,37,40)(H,38,39)/t24-,27+,28-,29-/m0/s1 |
| InChIKey | ZTQGTYFNOSQIGJ-LQBCTSRJSA-N |
| XLogP | 5.27 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.18 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|