C19H35ClSi — CID 91246606
chloro-dimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane (PubChem CID 91246606) has the molecular formula C19H35ClSi and a molecular weight of 327.03 g/mol. Its IUPAC name is chloro-dimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | chloro-dimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 91246606 |
| Molecular Formula | C19H35ClSi |
| Molecular Weight | 327.03 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | chloro-dimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC(C)C1=C(C(C)C)C([Si](C)(C)Cl)C(C(C)C)=C1C(C)C |
| InChI | InChI=1S/C19H35ClSi/c1-11(2)15-16(12(3)4)18(14(7)8)19(21(9,10)20)17(15)13(5)6/h11-14,19H,1-10H3 |
| InChIKey | FDBAVEMRFUPFSP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.03 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|