C10H11NO3 — CID 91247246
4-methoxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 91247246) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-methoxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-methoxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91247246 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-methoxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | COn1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C10H11NO3/c1-14-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13/h2-3,5-6,12-13H,4H2,1H3 |
| InChIKey | MODYTLVRRYYLKR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|