C31H39N5O4 — CID 91247442
N-[[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-ethylphenyl]methyl]acetamide (PubChem CID 91247442) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-[[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-ethylphenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-ethylphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 91247442 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | N-[[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-ethylphenyl]methyl]acetamide |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)ccc1CNC(C)=O |
| InChI | InChI=1S/C31H39N5O4/c1-5-23-15-22(10-11-24(23)18-32-21(4)37)12-13-31(25-8-6-7-9-25)17-27(38)26(29(39)40-31)16-28-34-30-33-19(2)14-20(3)36(30)35-28/h10-11,14-15,25-26H,5-9,12-13,16-18H2,1-4H3,(H,32,37) |
| InChIKey | ROSUQOSYENOHPJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|